C22H26N2O2 — CID 135544426
2-[[(1R,3R)-3-[(2-hydroxyphenyl)methylideneamino]-2,2,3-trimethylcyclopentyl]iminomethyl]phenol (PubChem CID 135544426) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-[[(1R,3R)-3-[(2-hydroxyphenyl)methylideneamino]-2,2,3-trimethylcyclopentyl]iminomethyl]phenol.
| Compound Name | 2-[[(1R,3R)-3-[(2-hydroxyphenyl)methylideneamino]-2,2,3-trimethylcyclopentyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135544426 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[[(1R,3R)-3-[(2-hydroxyphenyl)methylideneamino]-2,2,3-trimethylcyclopentyl]iminomethyl]phenol |
| SMILES | CC1(C)[C@H](/N=C/c2ccccc2O)CC[C@@]1(C)/N=C/c1ccccc1O |
| InChI | InChI=1S/C22H26N2O2/c1-21(2)20(23-14-16-8-4-6-10-18(16)25)12-13-22(21,3)24-15-17-9-5-7-11-19(17)26/h4-11,14-15,20,25-26H,12-13H2,1-3H3/b23-14+,24-15+/t20-,22-/m1/s1 |
| InChIKey | WXLUPJRQLHWGNK-GTQHNUQPSA-N |
| XLogP | 4.58 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|