C57H47N3O2P2+2 — CID 137254883
[4-hydroxy-3-[[3-[[2-hydroxy-5-(triphenylphosphaniumylmethyl)phenyl]methylideneamino]-4-pyridinyl]iminomethyl]phenyl]methyl-triphenylphosphanium (PubChem CID 137254883) has the molecular formula C57H47N3O2P2+2 and a molecular weight of 867.97 g/mol. Its IUPAC name is [4-hydroxy-3-[[3-[[2-hydroxy-5-(triphenylphosphaniumylmethyl)phenyl]methylideneamino]-4-pyridinyl]iminomethyl]phenyl]methyl-triphenylphosphanium.
| Compound Name | [4-hydroxy-3-[[3-[[2-hydroxy-5-(triphenylphosphaniumylmethyl)phenyl]methylideneamino]-4-pyridinyl]iminomethyl]phenyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 137254883 |
| Molecular Formula | C57H47N3O2P2+2 |
| Molecular Weight | 867.97 g/mol |
| Exact Mass | 867.31 |
| IUPAC Name | [4-hydroxy-3-[[3-[[2-hydroxy-5-(triphenylphosphaniumylmethyl)phenyl]methylideneamino]-4-pyridinyl]iminomethyl]phenyl]methyl-triphenylphosphanium |
| SMILES | Oc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1/C=N/c1ccncc1/N=C/c1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)ccc1O |
| InChI | InChI=1S/C57H45N3O2P2/c61-56-33-31-44(42-63(48-19-7-1-8-20-48,49-21-9-2-10-22-49)50-23-11-3-12-24-50)37-46(56)39-59-54-35-36-58-41-55(54)60-40-47-38-45(32-34-57(47)62)43-64(51-25-13-4-14-26-51,52-27-15-5-16-28-52)53-29-17-6-18-30-53/h1-41H,42-43H2/p+2 |
| InChIKey | JDRZZDNCWVNGEO-UHFFFAOYSA-P |
| XLogP | 10.98 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.97 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|