C23H18Cl3PS — CID 86633161
(2,5-dichlorothiophen-3-yl)methyl-triphenylphosphanium chloride (PubChem CID 86633161) has the molecular formula C23H18Cl3PS and a molecular weight of 463.80 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)methyl-triphenylphosphanium chloride.
| Compound Name | (2,5-dichlorothiophen-3-yl)methyl-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 86633161 |
| Molecular Formula | C23H18Cl3PS |
| Molecular Weight | 463.80 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)methyl-triphenylphosphanium chloride |
| SMILES | Clc1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(Cl)s1.[Cl-] |
| InChI | InChI=1S/C23H18Cl2PS.ClH/c24-22-16-18(23(25)27-22)17-26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21;/h1-16H,17H2;1H/q+1;/p-1 |
| InChIKey | ONPDFOFWERRRLR-UHFFFAOYSA-M |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|