C33H47NO8 — CID 163598644
(2S,4S,5S,7S)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-5-(phenylmethoxycarbonylamino)-2-prop-1-en-2-ylnonanoic acid (PubChem CID 163598644) has the molecular formula C33H47NO8 and a molecular weight of 585.74 g/mol. Its IUPAC name is (2S,4S,5S,7S)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-5-(phenylmethoxycarbonylamino)-2-prop-1-en-2-ylnonanoic acid.
| Compound Name | (2S,4S,5S,7S)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-5-(phenylmethoxycarbonylamino)-2-prop-1-en-2-ylnonanoic acid |
|---|---|
| PubChem CID | 163598644 |
| Molecular Formula | C33H47NO8 |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | (2S,4S,5S,7S)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-5-(phenylmethoxycarbonylamino)-2-prop-1-en-2-ylnonanoic acid |
| SMILES | C=C(C)[C@H](C[C@H](O)[C@H](C[C@H](Cc1ccc(OC)c(OCCCOC)c1)C(C)C)NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C33H47NO8/c1-22(2)26(17-25-13-14-30(40-6)31(18-25)41-16-10-15-39-5)19-28(29(35)20-27(23(3)4)32(36)37)34-33(38)42-21-24-11-8-7-9-12-24/h7-9,11-14,18,22,26-29,35H,3,10,15-17,19-21H2,1-2,4-6H3,(H,34,38)(H,36,37)/t26-,27-,28-,29-/m0/s1 |
| InChIKey | GVRORGLKOSGOMV-DZUOILHNSA-N |
| XLogP | 5.64 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|