C32H40N2O6S — CID 71750096
S-pyridin-2-yl (2S,4S)-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-2-(phenylmethoxycarbonylamino)hexanethioate (PubChem CID 71750096) has the molecular formula C32H40N2O6S and a molecular weight of 580.75 g/mol. Its IUPAC name is S-pyridin-2-yl (2S,4S)-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-2-(phenylmethoxycarbonylamino)hexanethioate.
| Compound Name | S-pyridin-2-yl (2S,4S)-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-2-(phenylmethoxycarbonylamino)hexanethioate |
|---|---|
| PubChem CID | 71750096 |
| Molecular Formula | C32H40N2O6S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | S-pyridin-2-yl (2S,4S)-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-2-(phenylmethoxycarbonylamino)hexanethioate |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](NC(=O)OCc2ccccc2)C(=O)Sc2ccccn2)C(C)C)ccc1OC |
| InChI | InChI=1S/C32H40N2O6S/c1-23(2)26(19-25-14-15-28(38-4)29(20-25)39-18-10-17-37-3)21-27(31(35)41-30-13-8-9-16-33-30)34-32(36)40-22-24-11-6-5-7-12-24/h5-9,11-16,20,23,26-27H,10,17-19,21-22H2,1-4H3,(H,34,36)/t26-,27-/m0/s1 |
| InChIKey | OPZXILOSFGIXFZ-SVBPBHIXSA-N |
| XLogP | 6.32 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|