C25H41N3O10 — CID 68895046
[(2S,3S,5S)-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-[(2-methyl-2-nitrooxypropanoyl)amino]heptan-3-yl]carbamic acid (PubChem CID 68895046) has the molecular formula C25H41N3O10 and a molecular weight of 543.61 g/mol. Its IUPAC name is [(2S,3S,5S)-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-[(2-methyl-2-nitrooxypropanoyl)amino]heptan-3-yl]carbamic acid.
| Compound Name | [(2S,3S,5S)-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-[(2-methyl-2-nitrooxypropanoyl)amino]heptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68895046 |
| Molecular Formula | C25H41N3O10 |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | [(2S,3S,5S)-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-[(2-methyl-2-nitrooxypropanoyl)amino]heptan-3-yl]carbamic acid |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](NC(=O)O)[C@@H](O)CNC(=O)C(C)(C)O[N+](=O)[O-])C(C)C)ccc1OC |
| InChI | InChI=1S/C25H41N3O10/c1-16(2)18(12-17-8-9-21(36-6)22(13-17)37-11-7-10-35-5)14-19(27-24(31)32)20(29)15-26-23(30)25(3,4)38-28(33)34/h8-9,13,16,18-20,27,29H,7,10-12,14-15H2,1-6H3,(H,26,30)(H,31,32)/t18-,19-,20-/m0/s1 |
| InChIKey | IHAVUJPOSDPDFR-UFYCRDLUSA-N |
| XLogP | 2.42 |
| TPSA | 178.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|