C29H52ClN3O7S — CID 23625024
(2R,4S,5S,7S)-5-amino-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanamide;hydrochloride (PubChem CID 23625024) has the molecular formula C29H52ClN3O7S and a molecular weight of 622.27 g/mol. Its IUPAC name is (2R,4S,5S,7S)-5-amino-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanamide;hydrochloride.
| Compound Name | (2R,4S,5S,7S)-5-amino-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanamide;hydrochloride |
|---|---|
| PubChem CID | 23625024 |
| Molecular Formula | C29H52ClN3O7S |
| Molecular Weight | 622.27 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | (2R,4S,5S,7S)-5-amino-N-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethylnonanamide;hydrochloride |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@@H](C)C(=O)NCCN2CCS(=O)(=O)CC2)C(C)C)ccc1OC.Cl |
| InChI | InChI=1S/C29H51N3O7S.ClH/c1-21(2)24(18-23-7-8-27(38-5)28(19-23)39-14-6-13-37-4)20-25(30)26(33)17-22(3)29(34)31-9-10-32-11-15-40(35,36)16-12-32;/h7-8,19,21-22,24-26,33H,6,9-18,20,30H2,1-5H3,(H,31,34);1H/t22-,24+,25+,26+;/m1./s1 |
| InChIKey | SYKXCULHKCGIFZ-RQWUYHMCSA-N |
| XLogP | 2.30 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|