C29H22F4N2O4 — CID 2421298
N-[[(2,6-difluorobenzoyl)amino]-(3-methoxy-4-phenylmethoxyphenyl)methyl]-2,6-difluorobenzamide (PubChem CID 2421298) has the molecular formula C29H22F4N2O4 and a molecular weight of 538.50 g/mol. Its IUPAC name is N-[[(2,6-difluorobenzoyl)amino]-(3-methoxy-4-phenylmethoxyphenyl)methyl]-2,6-difluorobenzamide.
| Compound Name | N-[[(2,6-difluorobenzoyl)amino]-(3-methoxy-4-phenylmethoxyphenyl)methyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 2421298 |
| Molecular Formula | C29H22F4N2O4 |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | N-[[(2,6-difluorobenzoyl)amino]-(3-methoxy-4-phenylmethoxyphenyl)methyl]-2,6-difluorobenzamide |
| SMILES | COc1cc(C(NC(=O)c2c(F)cccc2F)NC(=O)c2c(F)cccc2F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H22F4N2O4/c1-38-24-15-18(13-14-23(24)39-16-17-7-3-2-4-8-17)27(34-28(36)25-19(30)9-5-10-20(25)31)35-29(37)26-21(32)11-6-12-22(26)33/h2-15,27H,16H2,1H3,(H,34,36)(H,35,37) |
| InChIKey | APJZNXSUQUMUNA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|