C16H13ClF2N2O2 — CID 2340459
4-chloro-N'-[1-[4-(difluoromethoxy)phenyl]ethenyl]benzohydrazide (PubChem CID 2340459) has the molecular formula C16H13ClF2N2O2 and a molecular weight of 338.74 g/mol. Its IUPAC name is 4-chloro-N'-[1-[4-(difluoromethoxy)phenyl]ethenyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[1-[4-(difluoromethoxy)phenyl]ethenyl]benzohydrazide |
|---|---|
| PubChem CID | 2340459 |
| Molecular Formula | C16H13ClF2N2O2 |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 4-chloro-N'-[1-[4-(difluoromethoxy)phenyl]ethenyl]benzohydrazide |
| SMILES | C=C(NNC(=O)c1ccc(Cl)cc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H13ClF2N2O2/c1-10(11-4-8-14(9-5-11)23-16(18)19)20-21-15(22)12-2-6-13(17)7-3-12/h2-9,16,20H,1H2,(H,21,22) |
| InChIKey | JIGFFTDDTGAGSN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|