C26H26N4O7 — CID 11191374
N-(2-acetyl-4,5-dimethoxyphenyl)-3-[4-[(2-nitrophenyl)carbamoylamino]phenyl]propanamide (PubChem CID 11191374) has the molecular formula C26H26N4O7 and a molecular weight of 506.52 g/mol. Its IUPAC name is N-(2-acetyl-4,5-dimethoxyphenyl)-3-[4-[(2-nitrophenyl)carbamoylamino]phenyl]propanamide.
| Compound Name | N-(2-acetyl-4,5-dimethoxyphenyl)-3-[4-[(2-nitrophenyl)carbamoylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 11191374 |
| Molecular Formula | C26H26N4O7 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N-(2-acetyl-4,5-dimethoxyphenyl)-3-[4-[(2-nitrophenyl)carbamoylamino]phenyl]propanamide |
| SMILES | COc1cc(NC(=O)CCc2ccc(NC(=O)Nc3ccccc3[N+](=O)[O-])cc2)c(C(C)=O)cc1OC |
| InChI | InChI=1S/C26H26N4O7/c1-16(31)19-14-23(36-2)24(37-3)15-21(19)28-25(32)13-10-17-8-11-18(12-9-17)27-26(33)29-20-6-4-5-7-22(20)30(34)35/h4-9,11-12,14-15H,10,13H2,1-3H3,(H,28,32)(H2,27,29,33) |
| InChIKey | UXGHRKFHPOYRCZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|