C27H28N4O7 — CID 70106702
2-(2-acetyl-4,5-dimethoxyphenyl)-4-[4-[(4-nitrophenyl)carbamoylamino]phenyl]butanamide (PubChem CID 70106702) has the molecular formula C27H28N4O7 and a molecular weight of 520.54 g/mol. Its IUPAC name is 2-(2-acetyl-4,5-dimethoxyphenyl)-4-[4-[(4-nitrophenyl)carbamoylamino]phenyl]butanamide.
| Compound Name | 2-(2-acetyl-4,5-dimethoxyphenyl)-4-[4-[(4-nitrophenyl)carbamoylamino]phenyl]butanamide |
|---|---|
| PubChem CID | 70106702 |
| Molecular Formula | C27H28N4O7 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 2-(2-acetyl-4,5-dimethoxyphenyl)-4-[4-[(4-nitrophenyl)carbamoylamino]phenyl]butanamide |
| SMILES | COc1cc(C(C)=O)c(C(CCc2ccc(NC(=O)Nc3ccc([N+](=O)[O-])cc3)cc2)C(N)=O)cc1OC |
| InChI | InChI=1S/C27H28N4O7/c1-16(32)22-14-24(37-2)25(38-3)15-23(22)21(26(28)33)13-6-17-4-7-18(8-5-17)29-27(34)30-19-9-11-20(12-10-19)31(35)36/h4-5,7-12,14-15,21H,6,13H2,1-3H3,(H2,28,33)(H2,29,30,34) |
| InChIKey | VNUGTWDCMDBVCA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 162.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|