C26H28N4O5 — CID 70106960
2-(2-acetyl-4,5-dimethoxyphenyl)-3-[2-[(4-aminophenyl)carbamoylamino]phenyl]propanamide (PubChem CID 70106960) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-(2-acetyl-4,5-dimethoxyphenyl)-3-[2-[(4-aminophenyl)carbamoylamino]phenyl]propanamide.
| Compound Name | 2-(2-acetyl-4,5-dimethoxyphenyl)-3-[2-[(4-aminophenyl)carbamoylamino]phenyl]propanamide |
|---|---|
| PubChem CID | 70106960 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-(2-acetyl-4,5-dimethoxyphenyl)-3-[2-[(4-aminophenyl)carbamoylamino]phenyl]propanamide |
| SMILES | COc1cc(C(C)=O)c(C(Cc2ccccc2NC(=O)Nc2ccc(N)cc2)C(N)=O)cc1OC |
| InChI | InChI=1S/C26H28N4O5/c1-15(31)19-13-23(34-2)24(35-3)14-20(19)21(25(28)32)12-16-6-4-5-7-22(16)30-26(33)29-18-10-8-17(27)9-11-18/h4-11,13-14,21H,12,27H2,1-3H3,(H2,28,32)(H2,29,30,33) |
| InChIKey | ORDOXLTYXIXBES-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|