C27H30N4O6 — CID 70104923
ethyl 2-[1-amino-2-[4-[(4-aminophenyl)carbamoylamino]phenyl]-1-oxopropan-2-yl]-4,5-dimethoxybenzoate (PubChem CID 70104923) has the molecular formula C27H30N4O6 and a molecular weight of 506.56 g/mol. Its IUPAC name is ethyl 2-[1-amino-2-[4-[(4-aminophenyl)carbamoylamino]phenyl]-1-oxopropan-2-yl]-4,5-dimethoxybenzoate.
| Compound Name | ethyl 2-[1-amino-2-[4-[(4-aminophenyl)carbamoylamino]phenyl]-1-oxopropan-2-yl]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 70104923 |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | ethyl 2-[1-amino-2-[4-[(4-aminophenyl)carbamoylamino]phenyl]-1-oxopropan-2-yl]-4,5-dimethoxybenzoate |
| SMILES | CCOC(=O)c1cc(OC)c(OC)cc1C(C)(C(N)=O)c1ccc(NC(=O)Nc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C27H30N4O6/c1-5-37-24(32)20-14-22(35-3)23(36-4)15-21(20)27(2,25(29)33)16-6-10-18(11-7-16)30-26(34)31-19-12-8-17(28)9-13-19/h6-15H,5,28H2,1-4H3,(H2,29,33)(H2,30,31,34) |
| InChIKey | BOFLZCMMINYBSL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|