C28H30N4O6 — CID 139699708
diethyl 2,5-bis[2-(4-aminoanilino)-2-oxoethyl]benzene-1,4-dicarboxylate (PubChem CID 139699708) has the molecular formula C28H30N4O6 and a molecular weight of 518.57 g/mol. Its IUPAC name is diethyl 2,5-bis[2-(4-aminoanilino)-2-oxoethyl]benzene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis[2-(4-aminoanilino)-2-oxoethyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139699708 |
| Molecular Formula | C28H30N4O6 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | diethyl 2,5-bis[2-(4-aminoanilino)-2-oxoethyl]benzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(CC(=O)Nc2ccc(N)cc2)c(C(=O)OCC)cc1CC(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C28H30N4O6/c1-3-37-27(35)23-13-18(16-26(34)32-22-11-7-20(30)8-12-22)24(28(36)38-4-2)14-17(23)15-25(33)31-21-9-5-19(29)6-10-21/h5-14H,3-4,15-16,29-30H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | BRQVFPARFKJYQL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|