C20H22N2O6 — CID 70105532
[4-[3-(2-acetyl-4,5-dimethoxyanilino)-3-oxopropyl]phenyl]carbamic acid (PubChem CID 70105532) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is [4-[3-(2-acetyl-4,5-dimethoxyanilino)-3-oxopropyl]phenyl]carbamic acid.
| Compound Name | [4-[3-(2-acetyl-4,5-dimethoxyanilino)-3-oxopropyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 70105532 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [4-[3-(2-acetyl-4,5-dimethoxyanilino)-3-oxopropyl]phenyl]carbamic acid |
| SMILES | COc1cc(NC(=O)CCc2ccc(NC(=O)O)cc2)c(C(C)=O)cc1OC |
| InChI | InChI=1S/C20H22N2O6/c1-12(23)15-10-17(27-2)18(28-3)11-16(15)22-19(24)9-6-13-4-7-14(8-5-13)21-20(25)26/h4-5,7-8,10-11,21H,6,9H2,1-3H3,(H,22,24)(H,25,26) |
| InChIKey | NDIHJBOWWZSJOK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |