C25H25N5O7 — CID 70106322
4,5-dimethoxy-2-[3-[4-[(2-nitrophenyl)carbamoylamino]phenyl]propanoylamino]benzamide (PubChem CID 70106322) has the molecular formula C25H25N5O7 and a molecular weight of 507.50 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[3-[4-[(2-nitrophenyl)carbamoylamino]phenyl]propanoylamino]benzamide.
| Compound Name | 4,5-dimethoxy-2-[3-[4-[(2-nitrophenyl)carbamoylamino]phenyl]propanoylamino]benzamide |
|---|---|
| PubChem CID | 70106322 |
| Molecular Formula | C25H25N5O7 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 4,5-dimethoxy-2-[3-[4-[(2-nitrophenyl)carbamoylamino]phenyl]propanoylamino]benzamide |
| SMILES | COc1cc(NC(=O)CCc2ccc(NC(=O)Nc3ccccc3[N+](=O)[O-])cc2)c(C(N)=O)cc1OC |
| InChI | InChI=1S/C25H25N5O7/c1-36-21-13-17(24(26)32)19(14-22(21)37-2)28-23(31)12-9-15-7-10-16(11-8-15)27-25(33)29-18-5-3-4-6-20(18)30(34)35/h3-8,10-11,13-14H,9,12H2,1-2H3,(H2,26,32)(H,28,31)(H2,27,29,33) |
| InChIKey | PQIVAHSWSMCPPK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 174.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|