C14H16Cl2N2O5 — CID 78828996
2,2-dichloro-N-(4,5-diethoxy-2-nitrophenyl)cyclopropane-1-carboxamide (PubChem CID 78828996) has the molecular formula C14H16Cl2N2O5 and a molecular weight of 363.20 g/mol. Its IUPAC name is 2,2-dichloro-N-(4,5-diethoxy-2-nitrophenyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(4,5-diethoxy-2-nitrophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78828996 |
| Molecular Formula | C14H16Cl2N2O5 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2,2-dichloro-N-(4,5-diethoxy-2-nitrophenyl)cyclopropane-1-carboxamide |
| SMILES | CCOc1cc(NC(=O)C2CC2(Cl)Cl)c([N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C14H16Cl2N2O5/c1-3-22-11-5-9(17-13(19)8-7-14(8,15)16)10(18(20)21)6-12(11)23-4-2/h5-6,8H,3-4,7H2,1-2H3,(H,17,19) |
| InChIKey | PGSNUZHHUDPBJI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|