C17H24N4O7 — CID 167876993
5-[[(4,5-diethoxy-2-nitrophenyl)carbamoylamino]methyl]oxolane-2-carboxamide (PubChem CID 167876993) has the molecular formula C17H24N4O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is 5-[[(4,5-diethoxy-2-nitrophenyl)carbamoylamino]methyl]oxolane-2-carboxamide.
| Compound Name | 5-[[(4,5-diethoxy-2-nitrophenyl)carbamoylamino]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167876993 |
| Molecular Formula | C17H24N4O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 5-[[(4,5-diethoxy-2-nitrophenyl)carbamoylamino]methyl]oxolane-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)NCC2CCC(C(N)=O)O2)c([N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C17H24N4O7/c1-3-26-14-7-11(12(21(24)25)8-15(14)27-4-2)20-17(23)19-9-10-5-6-13(28-10)16(18)22/h7-8,10,13H,3-6,9H2,1-2H3,(H2,18,22)(H2,19,20,23) |
| InChIKey | HYRSCNKSHYNIRH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 155.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|