C15H19N3O4 — CID 75380134
5-[[(4-acetylphenyl)carbamoylamino]methyl]oxolane-2-carboxamide (PubChem CID 75380134) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 5-[[(4-acetylphenyl)carbamoylamino]methyl]oxolane-2-carboxamide.
| Compound Name | 5-[[(4-acetylphenyl)carbamoylamino]methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 75380134 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 5-[[(4-acetylphenyl)carbamoylamino]methyl]oxolane-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)NCC2CCC(C(N)=O)O2)cc1 |
| InChI | InChI=1S/C15H19N3O4/c1-9(19)10-2-4-11(5-3-10)18-15(21)17-8-12-6-7-13(22-12)14(16)20/h2-5,12-13H,6-8H2,1H3,(H2,16,20)(H2,17,18,21) |
| InChIKey | VZNLTSUEMHUGBK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |