C17H22ClN3O — CID 86968262
N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-methylhexanamide (PubChem CID 86968262) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-methylhexanamide.
| Compound Name | N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-methylhexanamide |
|---|---|
| PubChem CID | 86968262 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-methylhexanamide |
| SMILES | CCCC(C)CC(=O)NCc1cnn(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H22ClN3O/c1-3-4-13(2)9-17(22)19-10-14-11-20-21(12-14)16-7-5-15(18)6-8-16/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,19,22) |
| InChIKey | NHYUYTIWPUADPM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |