C19H28ClN5O — CID 86970383
1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[1-(dimethylamino)-4-methylpentan-2-yl]urea (PubChem CID 86970383) has the molecular formula C19H28ClN5O and a molecular weight of 377.92 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[1-(dimethylamino)-4-methylpentan-2-yl]urea.
| Compound Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[1-(dimethylamino)-4-methylpentan-2-yl]urea |
|---|---|
| PubChem CID | 86970383 |
| Molecular Formula | C19H28ClN5O |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)pyrazol-4-yl]methyl]-3-[1-(dimethylamino)-4-methylpentan-2-yl]urea |
| SMILES | CC(C)CC(CN(C)C)NC(=O)NCc1cnn(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H28ClN5O/c1-14(2)9-17(13-24(3)4)23-19(26)21-10-15-11-22-25(12-15)18-7-5-16(20)6-8-18/h5-8,11-12,14,17H,9-10,13H2,1-4H3,(H2,21,23,26) |
| InChIKey | FYCSQNAHQVKBAC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |