C17H20ClN3O3 — CID 119352202
6-[[1-(4-chlorophenyl)-3-methylpyrazole-4-carbonyl]amino]hexanoic acid (PubChem CID 119352202) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is 6-[[1-(4-chlorophenyl)-3-methylpyrazole-4-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[1-(4-chlorophenyl)-3-methylpyrazole-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119352202 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 6-[[1-(4-chlorophenyl)-3-methylpyrazole-4-carbonyl]amino]hexanoic acid |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)cc1C(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C17H20ClN3O3/c1-12-15(17(24)19-10-4-2-3-5-16(22)23)11-21(20-12)14-8-6-13(18)7-9-14/h6-9,11H,2-5,10H2,1H3,(H,19,24)(H,22,23) |
| InChIKey | SXFWPNDJJKYCKF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|