C14H21N3O5S2 — CID 663930
methyl (2S)-4-methylsulfanyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]butanoate (PubChem CID 663930) has the molecular formula C14H21N3O5S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl (2S)-4-methylsulfanyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]butanoate.
| Compound Name | methyl (2S)-4-methylsulfanyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]butanoate |
|---|---|
| PubChem CID | 663930 |
| Molecular Formula | C14H21N3O5S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | methyl (2S)-4-methylsulfanyl-2-[(4-sulfamoylphenyl)methylcarbamoylamino]butanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H21N3O5S2/c1-22-13(18)12(7-8-23-2)17-14(19)16-9-10-3-5-11(6-4-10)24(15,20)21/h3-6,12H,7-9H2,1-2H3,(H2,15,20,21)(H2,16,17,19)/t12-/m0/s1 |
| InChIKey | NCLDUAMXEMDHNL-LBPRGKRZSA-N |
| XLogP | 0.43 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |