C14H23N3O2 — CID 87300907
(2S)-2,5-diamino-5-(1-phenylpropan-2-ylamino)pentanoic acid (PubChem CID 87300907) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is (2S)-2,5-diamino-5-(1-phenylpropan-2-ylamino)pentanoic acid.
| Compound Name | (2S)-2,5-diamino-5-(1-phenylpropan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 87300907 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (2S)-2,5-diamino-5-(1-phenylpropan-2-ylamino)pentanoic acid |
| SMILES | CC(Cc1ccccc1)NC(N)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H23N3O2/c1-10(9-11-5-3-2-4-6-11)17-13(16)8-7-12(15)14(18)19/h2-6,10,12-13,17H,7-9,15-16H2,1H3,(H,18,19)/t10?,12-,13?/m0/s1 |
| InChIKey | FZDMGMIUJVJQOF-YDGIUTOCSA-N |
| XLogP | 0.68 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|