C16H31N3O8S2 — CID 87300906
(2S)-2,5-diamino-5-(1-phenylpropan-2-ylamino)pentanoic acid;methanesulfonic acid (PubChem CID 87300906) has the molecular formula C16H31N3O8S2 and a molecular weight of 457.57 g/mol. Its IUPAC name is (2S)-2,5-diamino-5-(1-phenylpropan-2-ylamino)pentanoic acid;methanesulfonic acid.
| Compound Name | (2S)-2,5-diamino-5-(1-phenylpropan-2-ylamino)pentanoic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 87300906 |
| Molecular Formula | C16H31N3O8S2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (2S)-2,5-diamino-5-(1-phenylpropan-2-ylamino)pentanoic acid;methanesulfonic acid |
| SMILES | CC(Cc1ccccc1)NC(N)CC[C@H](N)C(=O)O.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C14H23N3O2.2CH4O3S/c1-10(9-11-5-3-2-4-6-11)17-13(16)8-7-12(15)14(18)19;2*1-5(2,3)4/h2-6,10,12-13,17H,7-9,15-16H2,1H3,(H,18,19);2*1H3,(H,2,3,4)/t10?,12-,13?;;/m0../s1 |
| InChIKey | POTAVQQIWUEDGE-MVQHYTGFSA-N |
| XLogP | -0.31 |
| TPSA | 210.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|