C13H18N4O2 — CID 115241223
2-amino-4-[(2-methyl-3H-benzimidazol-5-yl)methylamino]butanoic acid (PubChem CID 115241223) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-amino-4-[(2-methyl-3H-benzimidazol-5-yl)methylamino]butanoic acid.
| Compound Name | 2-amino-4-[(2-methyl-3H-benzimidazol-5-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 115241223 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-amino-4-[(2-methyl-3H-benzimidazol-5-yl)methylamino]butanoic acid |
| SMILES | Cc1nc2ccc(CNCCC(N)C(=O)O)cc2[nH]1 |
| InChI | InChI=1S/C13H18N4O2/c1-8-16-11-3-2-9(6-12(11)17-8)7-15-5-4-10(14)13(18)19/h2-3,6,10,15H,4-5,7,14H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | WCNBQFRYNLCVCQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|