C10H15N5 — CID 115260836
N-(hydrazinylmethyl)-1-(2-methyl-3H-benzimidazol-5-yl)methanamine (PubChem CID 115260836) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(hydrazinylmethyl)-1-(2-methyl-3H-benzimidazol-5-yl)methanamine.
| Compound Name | N-(hydrazinylmethyl)-1-(2-methyl-3H-benzimidazol-5-yl)methanamine |
|---|---|
| PubChem CID | 115260836 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-(hydrazinylmethyl)-1-(2-methyl-3H-benzimidazol-5-yl)methanamine |
| SMILES | Cc1nc2ccc(CNCNN)cc2[nH]1 |
| InChI | InChI=1S/C10H15N5/c1-7-14-9-3-2-8(4-10(9)15-7)5-12-6-13-11/h2-4,12-13H,5-6,11H2,1H3,(H,14,15) |
| InChIKey | LEBSSSZSKHCYSX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|