C14H19N3O2 — CID 116851631
methyl 2-amino-5-(2-methyl-3H-benzimidazol-5-yl)pentanoate (PubChem CID 116851631) has the molecular formula C14H19N3O2 and a molecular weight of 261.33 g/mol. Its IUPAC name is methyl 2-amino-5-(2-methyl-3H-benzimidazol-5-yl)pentanoate.
| Compound Name | methyl 2-amino-5-(2-methyl-3H-benzimidazol-5-yl)pentanoate |
|---|---|
| PubChem CID | 116851631 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | methyl 2-amino-5-(2-methyl-3H-benzimidazol-5-yl)pentanoate |
| SMILES | COC(=O)C(N)CCCc1ccc2nc(C)[nH]c2c1 |
| InChI | InChI=1S/C14H19N3O2/c1-9-16-12-7-6-10(8-13(12)17-9)4-3-5-11(15)14(18)19-2/h6-8,11H,3-5,15H2,1-2H3,(H,16,17) |
| InChIKey | VFQKULNRSWDOOX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |