C11H18N2 — CID 20848308
2-methyl-4-phenylbutane-1,3-diamine (PubChem CID 20848308) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-methyl-4-phenylbutane-1,3-diamine.
| Compound Name | 2-methyl-4-phenylbutane-1,3-diamine |
|---|---|
| PubChem CID | 20848308 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-methyl-4-phenylbutane-1,3-diamine |
| SMILES | CC(CN)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C11H18N2/c1-9(8-12)11(13)7-10-5-3-2-4-6-10/h2-6,9,11H,7-8,12-13H2,1H3 |
| InChIKey | RLTAONQWHNZIEI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |