C21H29BN2O5 — CID 159962758
[5-amino-6-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]hexyl]boronic acid;carbon dioxide (PubChem CID 159962758) has the molecular formula C21H29BN2O5 and a molecular weight of 400.28 g/mol. Its IUPAC name is [5-amino-6-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]hexyl]boronic acid;carbon dioxide.
| Compound Name | [5-amino-6-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]hexyl]boronic acid;carbon dioxide |
|---|---|
| PubChem CID | 159962758 |
| Molecular Formula | C21H29BN2O5 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [5-amino-6-[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]hexyl]boronic acid;carbon dioxide |
| SMILES | NC(CCCCB(O)O)CN[C@@H](c1ccccc1)[C@H](O)c1ccccc1.O=C=O |
| InChI | InChI=1S/C20H29BN2O3.CO2/c22-18(13-7-8-14-21(25)26)15-23-19(16-9-3-1-4-10-16)20(24)17-11-5-2-6-12-17;2-1-3/h1-6,9-12,18-20,23-26H,7-8,13-15,22H2;/t18?,19-,20+;/m0./s1 |
| InChIKey | ODNUECRQEIOWPR-MGPZMBRGSA-N |
| XLogP | 1.44 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|