C10H21NO4 — CID 104644120
2-hydroxy-3-[(1-hydroxy-4-methylpentan-2-yl)amino]-2-methylpropanoic acid (PubChem CID 104644120) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-hydroxy-3-[(1-hydroxy-4-methylpentan-2-yl)amino]-2-methylpropanoic acid.
| Compound Name | 2-hydroxy-3-[(1-hydroxy-4-methylpentan-2-yl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 104644120 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-hydroxy-3-[(1-hydroxy-4-methylpentan-2-yl)amino]-2-methylpropanoic acid |
| SMILES | CC(C)CC(CO)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C10H21NO4/c1-7(2)4-8(5-12)11-6-10(3,15)9(13)14/h7-8,11-12,15H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | PWSVWONGDQBPHI-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |