C13H28N2O2 — CID 54961686
2-[(1-hydroxy-4-methylpentan-2-yl)amino]-N-(3-methylbutan-2-yl)acetamide (PubChem CID 54961686) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-[(1-hydroxy-4-methylpentan-2-yl)amino]-N-(3-methylbutan-2-yl)acetamide.
| Compound Name | 2-[(1-hydroxy-4-methylpentan-2-yl)amino]-N-(3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 54961686 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2-[(1-hydroxy-4-methylpentan-2-yl)amino]-N-(3-methylbutan-2-yl)acetamide |
| SMILES | CC(C)CC(CO)NCC(=O)NC(C)C(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-9(2)6-12(8-16)14-7-13(17)15-11(5)10(3)4/h9-12,14,16H,6-8H2,1-5H3,(H,15,17) |
| InChIKey | KVIIFORLSHFOMS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |