C10H22N2O3 — CID 65313831
2-(1,3-dihydroxypropan-2-ylamino)-N-pentan-3-ylacetamide (PubChem CID 65313831) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(1,3-dihydroxypropan-2-ylamino)-N-pentan-3-ylacetamide.
| Compound Name | 2-(1,3-dihydroxypropan-2-ylamino)-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 65313831 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-(1,3-dihydroxypropan-2-ylamino)-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CNC(CO)CO |
| InChI | InChI=1S/C10H22N2O3/c1-3-8(4-2)12-10(15)5-11-9(6-13)7-14/h8-9,11,13-14H,3-7H2,1-2H3,(H,12,15) |
| InChIKey | QHGXWLLZIAZFAR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |