C8H15N3O2 — CID 43499785
N-(cyanomethyl)-2-(1-hydroxybutan-2-ylamino)acetamide (PubChem CID 43499785) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(1-hydroxybutan-2-ylamino)acetamide.
| Compound Name | N-(cyanomethyl)-2-(1-hydroxybutan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 43499785 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-(cyanomethyl)-2-(1-hydroxybutan-2-ylamino)acetamide |
| SMILES | CCC(CO)NCC(=O)NCC#N |
| InChI | InChI=1S/C8H15N3O2/c1-2-7(6-12)11-5-8(13)10-4-3-9/h7,11-12H,2,4-6H2,1H3,(H,10,13) |
| InChIKey | AZBCHQNJYFJPLL-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|