C12H26N2O — CID 60672078
N-(3-methylbutyl)-2-(pentan-3-ylamino)acetamide (PubChem CID 60672078) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-(pentan-3-ylamino)acetamide.
| Compound Name | N-(3-methylbutyl)-2-(pentan-3-ylamino)acetamide |
|---|---|
| PubChem CID | 60672078 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N-(3-methylbutyl)-2-(pentan-3-ylamino)acetamide |
| SMILES | CCC(CC)NCC(=O)NCCC(C)C |
| InChI | InChI=1S/C12H26N2O/c1-5-11(6-2)14-9-12(15)13-8-7-10(3)4/h10-11,14H,5-9H2,1-4H3,(H,13,15) |
| InChIKey | HOXWBTJSALJHEV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |