C10H20N2O3 — CID 83194407
(2S)-2-[[2-(3-methylbutylamino)-2-oxoethyl]amino]propanoic acid (PubChem CID 83194407) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2S)-2-[[2-(3-methylbutylamino)-2-oxoethyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-(3-methylbutylamino)-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 83194407 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2S)-2-[[2-(3-methylbutylamino)-2-oxoethyl]amino]propanoic acid |
| SMILES | CC(C)CCNC(=O)CN[C@@H](C)C(=O)O |
| InChI | InChI=1S/C10H20N2O3/c1-7(2)4-5-11-9(13)6-12-8(3)10(14)15/h7-8,12H,4-6H2,1-3H3,(H,11,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | SMCSXEIFPOUSOT-QMMMGPOBSA-N |
| XLogP | 0.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |