C9H19NO4 — CID 104644711
2-hydroxy-3-[(1-hydroxy-3-methylbutan-2-yl)amino]-2-methylpropanoic acid (PubChem CID 104644711) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is 2-hydroxy-3-[(1-hydroxy-3-methylbutan-2-yl)amino]-2-methylpropanoic acid.
| Compound Name | 2-hydroxy-3-[(1-hydroxy-3-methylbutan-2-yl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 104644711 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-hydroxy-3-[(1-hydroxy-3-methylbutan-2-yl)amino]-2-methylpropanoic acid |
| SMILES | CC(C)C(CO)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C9H19NO4/c1-6(2)7(4-11)10-5-9(3,14)8(12)13/h6-7,10-11,14H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | DWSDSLNFCOFHAJ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |