C15H32BN3O4 — CID 57415483
2-amino-6-borono-2-[3-(4-ethylpiperazin-1-yl)propyl]hexanoic acid (PubChem CID 57415483) has the molecular formula C15H32BN3O4 and a molecular weight of 329.25 g/mol. Its IUPAC name is 2-amino-6-borono-2-[3-(4-ethylpiperazin-1-yl)propyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[3-(4-ethylpiperazin-1-yl)propyl]hexanoic acid |
|---|---|
| PubChem CID | 57415483 |
| Molecular Formula | C15H32BN3O4 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 2-amino-6-borono-2-[3-(4-ethylpiperazin-1-yl)propyl]hexanoic acid |
| SMILES | CCN1CCN(CCCC(N)(CCCCB(O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C15H32BN3O4/c1-2-18-10-12-19(13-11-18)9-5-7-15(17,14(20)21)6-3-4-8-16(22)23/h22-23H,2-13,17H2,1H3,(H,20,21) |
| InChIKey | FFJFBFSKGTUCRE-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|