C21H33BN4O4 — CID 57414340
2-amino-6-borono-2-[3-[4-[(2-cyanophenyl)methyl]piperazin-1-yl]propyl]hexanoic acid (PubChem CID 57414340) has the molecular formula C21H33BN4O4 and a molecular weight of 416.33 g/mol. Its IUPAC name is 2-amino-6-borono-2-[3-[4-[(2-cyanophenyl)methyl]piperazin-1-yl]propyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[3-[4-[(2-cyanophenyl)methyl]piperazin-1-yl]propyl]hexanoic acid |
|---|---|
| PubChem CID | 57414340 |
| Molecular Formula | C21H33BN4O4 |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 2-amino-6-borono-2-[3-[4-[(2-cyanophenyl)methyl]piperazin-1-yl]propyl]hexanoic acid |
| SMILES | N#Cc1ccccc1CN1CCN(CCCC(N)(CCCCB(O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C21H33BN4O4/c23-16-18-6-1-2-7-19(18)17-26-14-12-25(13-15-26)11-5-9-21(24,20(27)28)8-3-4-10-22(29)30/h1-2,6-7,29-30H,3-5,8-15,17,24H2,(H,27,28) |
| InChIKey | SNLGQIWIFKTNLX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 134.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|