C21H34BFN4O5 — CID 160643583
2-amino-6-borono-2-[3-[4-[(2-fluoro-5-methylphenyl)carbamoyl]piperazin-1-yl]propyl]hexanoic acid (PubChem CID 160643583) has the molecular formula C21H34BFN4O5 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-amino-6-borono-2-[3-[4-[(2-fluoro-5-methylphenyl)carbamoyl]piperazin-1-yl]propyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[3-[4-[(2-fluoro-5-methylphenyl)carbamoyl]piperazin-1-yl]propyl]hexanoic acid |
|---|---|
| PubChem CID | 160643583 |
| Molecular Formula | C21H34BFN4O5 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 2-amino-6-borono-2-[3-[4-[(2-fluoro-5-methylphenyl)carbamoyl]piperazin-1-yl]propyl]hexanoic acid |
| SMILES | Cc1ccc(F)c(NC(=O)N2CCN(CCCC(N)(CCCCB(O)O)C(=O)O)CC2)c1 |
| InChI | InChI=1S/C21H34BFN4O5/c1-16-5-6-17(23)18(15-16)25-20(30)27-13-11-26(12-14-27)10-4-8-21(24,19(28)29)7-2-3-9-22(31)32/h5-6,15,31-32H,2-4,7-14,24H2,1H3,(H,25,30)(H,28,29) |
| InChIKey | DGNJWCPRJYUKLZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|