C14H22N4OS — CID 141244559
4-(aminosulfanylmethyl)-N-(2,5-dimethylphenyl)piperazine-1-carboxamide (PubChem CID 141244559) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-(aminosulfanylmethyl)-N-(2,5-dimethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(aminosulfanylmethyl)-N-(2,5-dimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 141244559 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-(aminosulfanylmethyl)-N-(2,5-dimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)N2CCN(CSN)CC2)c1 |
| InChI | InChI=1S/C14H22N4OS/c1-11-3-4-12(2)13(9-11)16-14(19)18-7-5-17(6-8-18)10-20-15/h3-4,9H,5-8,10,15H2,1-2H3,(H,16,19) |
| InChIKey | NPHDCAOBIZDCDD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|