C19H21F2N3O — CID 113111598
4-(2,6-difluorophenyl)-N-(2,5-dimethylphenyl)piperazine-1-carboxamide (PubChem CID 113111598) has the molecular formula C19H21F2N3O and a molecular weight of 345.39 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-N-(2,5-dimethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2,6-difluorophenyl)-N-(2,5-dimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113111598 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-(2,6-difluorophenyl)-N-(2,5-dimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)N2CCN(c3c(F)cccc3F)CC2)c1 |
| InChI | InChI=1S/C19H21F2N3O/c1-13-6-7-14(2)17(12-13)22-19(25)24-10-8-23(9-11-24)18-15(20)4-3-5-16(18)21/h3-7,12H,8-11H2,1-2H3,(H,22,25) |
| InChIKey | MDUCKZVZQJFQEK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |