C17H23N3O3S — CID 125499527
methyl 4-carbamothioyl-1-[(2,5-dimethylphenyl)carbamoyl]piperidine-4-carboxylate (PubChem CID 125499527) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is methyl 4-carbamothioyl-1-[(2,5-dimethylphenyl)carbamoyl]piperidine-4-carboxylate.
| Compound Name | methyl 4-carbamothioyl-1-[(2,5-dimethylphenyl)carbamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 125499527 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | methyl 4-carbamothioyl-1-[(2,5-dimethylphenyl)carbamoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1(C(N)=S)CCN(C(=O)Nc2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C17H23N3O3S/c1-11-4-5-12(2)13(10-11)19-16(22)20-8-6-17(7-9-20,14(18)24)15(21)23-3/h4-5,10H,6-9H2,1-3H3,(H2,18,24)(H,19,22) |
| InChIKey | AGCCPNBIBISNOF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|