C13H29BCl2N2O5 — CID 66833071
2-amino-6-borono-2-[2-(4-hydroxypiperidin-1-yl)ethyl]hexanoic acid;dihydrochloride (PubChem CID 66833071) has the molecular formula C13H29BCl2N2O5 and a molecular weight of 375.10 g/mol. Its IUPAC name is 2-amino-6-borono-2-[2-(4-hydroxypiperidin-1-yl)ethyl]hexanoic acid;dihydrochloride.
| Compound Name | 2-amino-6-borono-2-[2-(4-hydroxypiperidin-1-yl)ethyl]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 66833071 |
| Molecular Formula | C13H29BCl2N2O5 |
| Molecular Weight | 375.10 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-amino-6-borono-2-[2-(4-hydroxypiperidin-1-yl)ethyl]hexanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(CCCCB(O)O)(CCN1CCC(O)CC1)C(=O)O |
| InChI | InChI=1S/C13H27BN2O5.2ClH/c15-13(12(18)19,5-1-2-7-14(20)21)6-10-16-8-3-11(17)4-9-16;;/h11,17,20-21H,1-10,15H2,(H,18,19);2*1H |
| InChIKey | RLBDDNGYOGCKOR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.10 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|