C13H24BF3N2O4 — CID 66833203
2-amino-6-borono-2-[2-[2-(trifluoromethyl)pyrrolidin-1-yl]ethyl]hexanoic acid (PubChem CID 66833203) has the molecular formula C13H24BF3N2O4 and a molecular weight of 340.15 g/mol. Its IUPAC name is 2-amino-6-borono-2-[2-[2-(trifluoromethyl)pyrrolidin-1-yl]ethyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[2-[2-(trifluoromethyl)pyrrolidin-1-yl]ethyl]hexanoic acid |
|---|---|
| PubChem CID | 66833203 |
| Molecular Formula | C13H24BF3N2O4 |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-amino-6-borono-2-[2-[2-(trifluoromethyl)pyrrolidin-1-yl]ethyl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(CCN1CCCC1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H24BF3N2O4/c15-13(16,17)10-4-3-8-19(10)9-6-12(18,11(20)21)5-1-2-7-14(22)23/h10,22-23H,1-9,18H2,(H,20,21) |
| InChIKey | GZHMPPXUSXUWNV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|