C12H25BN2O4 — CID 66832903
2-amino-6-borono-2-(2-pyrrolidin-2-ylethyl)hexanoic acid (PubChem CID 66832903) has the molecular formula C12H25BN2O4 and a molecular weight of 272.15 g/mol. Its IUPAC name is 2-amino-6-borono-2-(2-pyrrolidin-2-ylethyl)hexanoic acid.
| Compound Name | 2-amino-6-borono-2-(2-pyrrolidin-2-ylethyl)hexanoic acid |
|---|---|
| PubChem CID | 66832903 |
| Molecular Formula | C12H25BN2O4 |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-amino-6-borono-2-(2-pyrrolidin-2-ylethyl)hexanoic acid |
| SMILES | NC(CCCCB(O)O)(CCC1CCCN1)C(=O)O |
| InChI | InChI=1S/C12H25BN2O4/c14-12(11(16)17,6-1-2-8-13(18)19)7-5-10-4-3-9-15-10/h10,15,18-19H,1-9,14H2,(H,16,17) |
| InChIKey | NRIZPZYOASHKTI-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|