C10H23BCl2N2O5 — CID 66833250
2-amino-6-borono-2-morpholin-2-ylhexanoic acid;dihydrochloride (PubChem CID 66833250) has the molecular formula C10H23BCl2N2O5 and a molecular weight of 333.02 g/mol. Its IUPAC name is 2-amino-6-borono-2-morpholin-2-ylhexanoic acid;dihydrochloride.
| Compound Name | 2-amino-6-borono-2-morpholin-2-ylhexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 66833250 |
| Molecular Formula | C10H23BCl2N2O5 |
| Molecular Weight | 333.02 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-amino-6-borono-2-morpholin-2-ylhexanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(CCCCB(O)O)(C(=O)O)C1CNCCO1 |
| InChI | InChI=1S/C10H21BN2O5.2ClH/c12-10(9(14)15,3-1-2-4-11(16)17)8-7-13-5-6-18-8;;/h8,13,16-17H,1-7,12H2,(H,14,15);2*1H |
| InChIKey | APISFMBIXHPCHO-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.02 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|