C13H27BN2O4 — CID 66832725
6-borono-2-(methylamino)-2-[2-[(2S)-pyrrolidin-2-yl]ethyl]hexanoic acid (PubChem CID 66832725) has the molecular formula C13H27BN2O4 and a molecular weight of 286.18 g/mol. Its IUPAC name is 6-borono-2-(methylamino)-2-[2-[(2S)-pyrrolidin-2-yl]ethyl]hexanoic acid.
| Compound Name | 6-borono-2-(methylamino)-2-[2-[(2S)-pyrrolidin-2-yl]ethyl]hexanoic acid |
|---|---|
| PubChem CID | 66832725 |
| Molecular Formula | C13H27BN2O4 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 6-borono-2-(methylamino)-2-[2-[(2S)-pyrrolidin-2-yl]ethyl]hexanoic acid |
| SMILES | CNC(CCCCB(O)O)(CC[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C13H27BN2O4/c1-15-13(12(17)18,7-2-3-9-14(19)20)8-6-11-5-4-10-16-11/h11,15-16,19-20H,2-10H2,1H3,(H,17,18)/t11-,13?/m0/s1 |
| InChIKey | PNJWEGOSFPPWFV-AMGKYWFPSA-N |
| XLogP | 0.20 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|