C14H29BN2O4 — CID 71600432
(2R)-6-borono-2-(methylamino)-2-(2-piperidin-1-ylethyl)hexanoic acid (PubChem CID 71600432) has the molecular formula C14H29BN2O4 and a molecular weight of 300.21 g/mol. Its IUPAC name is (2R)-6-borono-2-(methylamino)-2-(2-piperidin-1-ylethyl)hexanoic acid.
| Compound Name | (2R)-6-borono-2-(methylamino)-2-(2-piperidin-1-ylethyl)hexanoic acid |
|---|---|
| PubChem CID | 71600432 |
| Molecular Formula | C14H29BN2O4 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (2R)-6-borono-2-(methylamino)-2-(2-piperidin-1-ylethyl)hexanoic acid |
| SMILES | CN[C@](CCCCB(O)O)(CCN1CCCCC1)C(=O)O |
| InChI | InChI=1S/C14H29BN2O4/c1-16-14(13(18)19,7-3-4-9-15(20)21)8-12-17-10-5-2-6-11-17/h16,20-21H,2-12H2,1H3,(H,18,19)/t14-/m1/s1 |
| InChIKey | RGYLESKLFDZGCD-CQSZACIVSA-N |
| XLogP | 0.55 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|