C10H21BN2O4 — CID 66833419
2-amino-6-borono-2-pyrrolidin-3-ylhexanoic acid (PubChem CID 66833419) has the molecular formula C10H21BN2O4 and a molecular weight of 244.10 g/mol. Its IUPAC name is 2-amino-6-borono-2-pyrrolidin-3-ylhexanoic acid.
| Compound Name | 2-amino-6-borono-2-pyrrolidin-3-ylhexanoic acid |
|---|---|
| PubChem CID | 66833419 |
| Molecular Formula | C10H21BN2O4 |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-amino-6-borono-2-pyrrolidin-3-ylhexanoic acid |
| SMILES | NC(CCCCB(O)O)(C(=O)O)C1CCNC1 |
| InChI | InChI=1S/C10H21BN2O4/c12-10(9(14)15,8-3-6-13-7-8)4-1-2-5-11(16)17/h8,13,16-17H,1-7,12H2,(H,14,15) |
| InChIKey | VSMNBLJMRLYUTE-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|